C26H36O2S3 — CID 86057568
2,3-bis[5-(6-methoxyhexyl)thiophen-2-yl]thiophene (PubChem CID 86057568) has the molecular formula C26H36O2S3 and a molecular weight of 476.77 g/mol. Its IUPAC name is 2,3-bis[5-(6-methoxyhexyl)thiophen-2-yl]thiophene.
| Compound Name | 2,3-bis[5-(6-methoxyhexyl)thiophen-2-yl]thiophene |
|---|---|
| PubChem CID | 86057568 |
| Molecular Formula | C26H36O2S3 |
| Molecular Weight | 476.77 g/mol |
| Exact Mass | 476.19 |
| IUPAC Name | 2,3-bis[5-(6-methoxyhexyl)thiophen-2-yl]thiophene |
| SMILES | COCCCCCCc1ccc(-c2ccsc2-c2ccc(CCCCCCOC)s2)s1 |
| InChI | InChI=1S/C26H36O2S3/c1-27-18-9-5-3-7-11-21-13-15-24(30-21)23-17-20-29-26(23)25-16-14-22(31-25)12-8-4-6-10-19-28-2/h13-17,20H,3-12,18-19H2,1-2H3 |
| InChIKey | OICAXLXISJIIOB-UHFFFAOYSA-N |
| XLogP | 8.70 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.77 |
| LogP ≤ 5 | 8.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|