C13H13Br2FO — CID 86068150
5-(2,2-dibromo-2-fluoroethoxy)pent-3-ynylbenzene (PubChem CID 86068150) has the molecular formula C13H13Br2FO and a molecular weight of 364.05 g/mol. Its IUPAC name is 5-(2,2-dibromo-2-fluoroethoxy)pent-3-ynylbenzene.
| Compound Name | 5-(2,2-dibromo-2-fluoroethoxy)pent-3-ynylbenzene |
|---|---|
| PubChem CID | 86068150 |
| Molecular Formula | C13H13Br2FO |
| Molecular Weight | 364.05 g/mol |
| Exact Mass | 361.93 |
| IUPAC Name | 5-(2,2-dibromo-2-fluoroethoxy)pent-3-ynylbenzene |
| SMILES | FC(Br)(Br)COCC#CCCc1ccccc1 |
| InChI | InChI=1S/C13H13Br2FO/c14-13(15,16)11-17-10-6-2-5-9-12-7-3-1-4-8-12/h1,3-4,7-8H,5,9-11H2 |
| InChIKey | HBGLJNOHORUONB-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.05 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|