C17H18N3O4P — CID 86094455
N-bis(furan-2-ylmethylamino)phosphorylbenzamide (PubChem CID 86094455) has the molecular formula C17H18N3O4P and a molecular weight of 359.32 g/mol. Its IUPAC name is N-bis(furan-2-ylmethylamino)phosphorylbenzamide.
| Compound Name | N-bis(furan-2-ylmethylamino)phosphorylbenzamide |
|---|---|
| PubChem CID | 86094455 |
| Molecular Formula | C17H18N3O4P |
| Molecular Weight | 359.32 g/mol |
| Exact Mass | 359.10 |
| IUPAC Name | N-bis(furan-2-ylmethylamino)phosphorylbenzamide |
| SMILES | O=C(NP(=O)(NCc1ccco1)NCc1ccco1)c1ccccc1 |
| InChI | InChI=1S/C17H18N3O4P/c21-17(14-6-2-1-3-7-14)20-25(22,18-12-15-8-4-10-23-15)19-13-16-9-5-11-24-16/h1-11H,12-13H2,(H3,18,19,20,21,22) |
| InChIKey | UEWFDUZFZYKPCN-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 96.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.32 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|