azidophosphonous acid

H2N3O2P — CID 86122379

IUPACazidophosphonous acid
SMILES[N-]=[N+]=NP(O)O
InChIInChI=1S/H2N3O2P/c1-2-3-6(4)5/h4-5H
InChIKeyWVMIXTNFEWOVQI-UHFFFAOYSA-N
MW107.01 g/mol
LogP0.51
Rot. Bonds1

About azidophosphonous acid

azidophosphonous acid (PubChem CID 86122379) has the molecular formula H2N3O2P and a molecular weight of 107.01 g/mol. Its IUPAC name is azidophosphonous acid.

Molecular Properties

Compound Nameazidophosphonous acid
PubChem CID86122379
Molecular FormulaH2N3O2P
Molecular Weight107.01 g/mol
Exact Mass106.99
IUPAC Nameazidophosphonous acid
SMILES[N-]=[N+]=NP(O)O
InChIInChI=1S/H2N3O2P/c1-2-3-6(4)5/h4-5H
InChIKeyWVMIXTNFEWOVQI-UHFFFAOYSA-N
XLogP0.51
TPSA89.22 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms6
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500107.01
LogP ≤ 50.51
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'}

Analyze azidophosphonous acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of azidophosphonous acid?
The IUPAC name of azidophosphonous acid (CID 86122379) is azidophosphonous acid.
What is the SMILES notation for azidophosphonous acid?
The canonical SMILES for azidophosphonous acid is [N-]=[N+]=NP(O)O.
What is the InChIKey of azidophosphonous acid?
The InChIKey is WVMIXTNFEWOVQI-UHFFFAOYSA-N. The full InChI is InChI=1S/H2N3O2P/c1-2-3-6(4)5/h4-5H.
What are the key properties of azidophosphonous acid?
azidophosphonous acid has a molecular weight of 107.01 g/mol, XLogP of 0.51, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for azidophosphonous acid is sourced from PubChem (CID 86122379), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).