About azidophosphonous acid
azidophosphonous acid (PubChem CID 86122379) has the molecular formula H2N3O2P
and a molecular weight of 107.01 g/mol. Its IUPAC name is azidophosphonous acid.
Molecular Properties
| Compound Name | azidophosphonous acid |
| PubChem CID | 86122379 |
| Molecular Formula | H2N3O2P |
| Molecular Weight | 107.01 g/mol |
| Exact Mass | 106.99 |
| IUPAC Name | azidophosphonous acid |
| SMILES | [N-]=[N+]=NP(O)O |
| InChI | InChI=1S/H2N3O2P/c1-2-3-6(4)5/h4-5H |
| InChIKey | WVMIXTNFEWOVQI-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 89.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 107.01 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze azidophosphonous acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azidophosphonous acid?
The IUPAC name of azidophosphonous acid (CID 86122379) is azidophosphonous acid.
What is the SMILES notation for azidophosphonous acid?
The canonical SMILES for azidophosphonous acid is [N-]=[N+]=NP(O)O.
What is the InChIKey of azidophosphonous acid?
The InChIKey is WVMIXTNFEWOVQI-UHFFFAOYSA-N. The full InChI is InChI=1S/H2N3O2P/c1-2-3-6(4)5/h4-5H.
What are the key properties of azidophosphonous acid?
azidophosphonous acid has a molecular weight of 107.01 g/mol, XLogP of 0.51, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for azidophosphonous acid is sourced from PubChem (CID 86122379), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).