C20H17N5O4 — CID 86161614
2-[(5,6-diphenyl-1,2,4-triazin-3-yl)hydrazinylidene]pentanedioic acid (PubChem CID 86161614) has the molecular formula C20H17N5O4 and a molecular weight of 391.39 g/mol. Its IUPAC name is 2-[(5,6-diphenyl-1,2,4-triazin-3-yl)hydrazinylidene]pentanedioic acid.
| Compound Name | 2-[(5,6-diphenyl-1,2,4-triazin-3-yl)hydrazinylidene]pentanedioic acid |
|---|---|
| PubChem CID | 86161614 |
| Molecular Formula | C20H17N5O4 |
| Molecular Weight | 391.39 g/mol |
| Exact Mass | 391.13 |
| IUPAC Name | 2-[(5,6-diphenyl-1,2,4-triazin-3-yl)hydrazinylidene]pentanedioic acid |
| SMILES | O=C(O)CCC(=NNc1nnc(-c2ccccc2)c(-c2ccccc2)n1)C(=O)O |
| InChI | InChI=1S/C20H17N5O4/c26-16(27)12-11-15(19(28)29)22-24-20-21-17(13-7-3-1-4-8-13)18(23-25-20)14-9-5-2-6-10-14/h1-10H,11-12H2,(H,26,27)(H,28,29)(H,21,24,25) |
| InChIKey | LFLJPTDRPZKRRE-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 137.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.39 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|