C14H11Cl2NO — CID 86175023
N-(2,6-dichlorophenyl)-N-(4-methylphenyl)formamide (PubChem CID 86175023) has the molecular formula C14H11Cl2NO and a molecular weight of 280.15 g/mol. Its IUPAC name is N-(2,6-dichlorophenyl)-N-(4-methylphenyl)formamide.
| Compound Name | N-(2,6-dichlorophenyl)-N-(4-methylphenyl)formamide |
|---|---|
| PubChem CID | 86175023 |
| Molecular Formula | C14H11Cl2NO |
| Molecular Weight | 280.15 g/mol |
| Exact Mass | 279.02 |
| IUPAC Name | N-(2,6-dichlorophenyl)-N-(4-methylphenyl)formamide |
| SMILES | Cc1ccc(N(C=O)c2c(Cl)cccc2Cl)cc1 |
| InChI | InChI=1S/C14H11Cl2NO/c1-10-5-7-11(8-6-10)17(9-18)14-12(15)3-2-4-13(14)16/h2-9H,1H3 |
| InChIKey | WSXRYPQCZDIJQA-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.15 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|