C15H15N4+ — CID 86189828
2,6-dimethyl-4-phenyl-1-(1H-1,2,4-triazol-5-yl)pyridin-1-ium (PubChem CID 86189828) has the molecular formula C15H15N4+ and a molecular weight of 251.31 g/mol. Its IUPAC name is 2,6-dimethyl-4-phenyl-1-(1H-1,2,4-triazol-5-yl)pyridin-1-ium.
| Compound Name | 2,6-dimethyl-4-phenyl-1-(1H-1,2,4-triazol-5-yl)pyridin-1-ium |
|---|---|
| PubChem CID | 86189828 |
| Molecular Formula | C15H15N4+ |
| Molecular Weight | 251.31 g/mol |
| Exact Mass | 251.13 |
| IUPAC Name | 2,6-dimethyl-4-phenyl-1-(1H-1,2,4-triazol-5-yl)pyridin-1-ium |
| SMILES | Cc1cc(-c2ccccc2)cc(C)[n+]1-c1ncn[nH]1 |
| InChI | InChI=1S/C15H15N4/c1-11-8-14(13-6-4-3-5-7-13)9-12(2)19(11)15-16-10-17-18-15/h3-10H,1-2H3,(H,16,17,18)/q+1 |
| InChIKey | LDZVKGVFHRIMGI-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 45.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.31 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|