C22H21N4+ — CID 102094548
2,4-diphenyl-6-propan-2-yl-1-(1H-1,2,4-triazol-5-yl)pyridin-1-ium (PubChem CID 102094548) has the molecular formula C22H21N4+ and a molecular weight of 341.44 g/mol. Its IUPAC name is 2,4-diphenyl-6-propan-2-yl-1-(1H-1,2,4-triazol-5-yl)pyridin-1-ium.
| Compound Name | 2,4-diphenyl-6-propan-2-yl-1-(1H-1,2,4-triazol-5-yl)pyridin-1-ium |
|---|---|
| PubChem CID | 102094548 |
| Molecular Formula | C22H21N4+ |
| Molecular Weight | 341.44 g/mol |
| Exact Mass | 341.18 |
| IUPAC Name | 2,4-diphenyl-6-propan-2-yl-1-(1H-1,2,4-triazol-5-yl)pyridin-1-ium |
| SMILES | CC(C)c1cc(-c2ccccc2)cc(-c2ccccc2)[n+]1-c1ncn[nH]1 |
| InChI | InChI=1S/C22H21N4/c1-16(2)20-13-19(17-9-5-3-6-10-17)14-21(18-11-7-4-8-12-18)26(20)22-23-15-24-25-22/h3-16H,1-2H3,(H,23,24,25)/q+1 |
| InChIKey | YFVPXYJKYUGOJO-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 45.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.44 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|