C28H38O2S2 — CID 86225571
2-[4-(5,5-dimethyl-2-phenyl-1,3-oxathian-2-yl)butyl]-5,5-dimethyl-2-phenyl-1,3-oxathiane (PubChem CID 86225571) has the molecular formula C28H38O2S2 and a molecular weight of 470.74 g/mol. Its IUPAC name is 2-[4-(5,5-dimethyl-2-phenyl-1,3-oxathian-2-yl)butyl]-5,5-dimethyl-2-phenyl-1,3-oxathiane.
| Compound Name | 2-[4-(5,5-dimethyl-2-phenyl-1,3-oxathian-2-yl)butyl]-5,5-dimethyl-2-phenyl-1,3-oxathiane |
|---|---|
| PubChem CID | 86225571 |
| Molecular Formula | C28H38O2S2 |
| Molecular Weight | 470.74 g/mol |
| Exact Mass | 470.23 |
| IUPAC Name | 2-[4-(5,5-dimethyl-2-phenyl-1,3-oxathian-2-yl)butyl]-5,5-dimethyl-2-phenyl-1,3-oxathiane |
| SMILES | CC1(C)COC(CCCCC2(c3ccccc3)OCC(C)(C)CS2)(c2ccccc2)SC1 |
| InChI | InChI=1S/C28H38O2S2/c1-25(2)19-29-27(31-21-25,23-13-7-5-8-14-23)17-11-12-18-28(24-15-9-6-10-16-24)30-20-26(3,4)22-32-28/h5-10,13-16H,11-12,17-22H2,1-4H3 |
| InChIKey | HBIIEIYSVYQATO-UHFFFAOYSA-N |
| XLogP | 7.83 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.74 |
| LogP ≤ 5 | 7.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|