C6H8O2 — CID 86231989
4-methylidenepent-2-yne-1,5-diol (PubChem CID 86231989) has the molecular formula C6H8O2 and a molecular weight of 112.13 g/mol. Its IUPAC name is 4-methylidenepent-2-yne-1,5-diol.
| Compound Name | 4-methylidenepent-2-yne-1,5-diol |
|---|---|
| PubChem CID | 86231989 |
| Molecular Formula | C6H8O2 |
| Molecular Weight | 112.13 g/mol |
| Exact Mass | 112.05 |
| IUPAC Name | 4-methylidenepent-2-yne-1,5-diol |
| SMILES | C=C(C#CCO)CO |
| InChI | InChI=1S/C6H8O2/c1-6(5-8)3-2-4-7/h7-8H,1,4-5H2 |
| InChIKey | MAMSOAJHKBOOFJ-UHFFFAOYSA-N |
| XLogP | -0.47 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 112.13 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|