C12H16FN3S — CID 8624603
1-(2-fluorophenyl)-3-piperidin-1-ylthiourea (PubChem CID 8624603) has the molecular formula C12H16FN3S and a molecular weight of 253.35 g/mol. Its IUPAC name is 1-(2-fluorophenyl)-3-piperidin-1-ylthiourea.
| Compound Name | 1-(2-fluorophenyl)-3-piperidin-1-ylthiourea |
|---|---|
| PubChem CID | 8624603 |
| Molecular Formula | C12H16FN3S |
| Molecular Weight | 253.35 g/mol |
| Exact Mass | 253.10 |
| IUPAC Name | 1-(2-fluorophenyl)-3-piperidin-1-ylthiourea |
| SMILES | Fc1ccccc1NC(=S)NN1CCCCC1 |
| InChI | InChI=1S/C12H16FN3S/c13-10-6-2-3-7-11(10)14-12(17)15-16-8-4-1-5-9-16/h2-3,6-7H,1,4-5,8-9H2,(H2,14,15,17) |
| InChIKey | TZBUSILSEBEOMY-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.35 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|