C30H38FN3O6 — CID 86268623
[(10R,15S)-12-[4-(4-fluorophenyl)-4-oxobutyl]-4-methyl-1,4-diaza-12-azoniatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16)-trien-12-yl]methyl propan-2-yl carbonate formate (PubChem CID 86268623) has the molecular formula C30H38FN3O6 and a molecular weight of 555.65 g/mol. Its IUPAC name is [(10R,15S)-12-[4-(4-fluorophenyl)-4-oxobutyl]-4-methyl-1,4-diaza-12-azoniatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16)-trien-12-yl]methyl propan-2-yl carbonate formate.
| Compound Name | [(10R,15S)-12-[4-(4-fluorophenyl)-4-oxobutyl]-4-methyl-1,4-diaza-12-azoniatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16)-trien-12-yl]methyl propan-2-yl carbonate formate |
|---|---|
| PubChem CID | 86268623 |
| Molecular Formula | C30H38FN3O6 |
| Molecular Weight | 555.65 g/mol |
| Exact Mass | 555.27 |
| IUPAC Name | [(10R,15S)-12-[4-(4-fluorophenyl)-4-oxobutyl]-4-methyl-1,4-diaza-12-azoniatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16)-trien-12-yl]methyl propan-2-yl carbonate formate |
| SMILES | CC(C)OC(=O)OC[N+]1(CCCC(=O)c2ccc(F)cc2)CC[C@H]2[C@@H](C1)c1cccc3c1N2CCN3C.O=C[O-] |
| InChI | InChI=1S/C29H37FN3O4.CH2O2/c1-20(2)37-29(35)36-19-33(16-5-8-27(34)21-9-11-22(30)12-10-21)17-13-25-24(18-33)23-6-4-7-26-28(23)32(25)15-14-31(26)3;2-1-3/h4,6-7,9-12,20,24-25H,5,8,13-19H2,1-3H3;1H,(H,2,3)/q+1;/p-1/t24-,25-,33?;/m0./s1 |
| InChIKey | NJUVROJETGSAKP-DOUCHQRTSA-M |
| XLogP | 3.32 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.65 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|