C34H47FN3O3+ — CID 118697627
[(10R,15S)-12-[4-(4-fluorophenyl)-4-oxobutyl]-4-methyl-1,4-diaza-12-azoniatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16)-trien-12-yl]methyl 2-methyl-2-propylpentanoate (PubChem CID 118697627) has the molecular formula C34H47FN3O3+ and a molecular weight of 564.77 g/mol. Its IUPAC name is [(10R,15S)-12-[4-(4-fluorophenyl)-4-oxobutyl]-4-methyl-1,4-diaza-12-azoniatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16)-trien-12-yl]methyl 2-methyl-2-propylpentanoate.
| Compound Name | [(10R,15S)-12-[4-(4-fluorophenyl)-4-oxobutyl]-4-methyl-1,4-diaza-12-azoniatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16)-trien-12-yl]methyl 2-methyl-2-propylpentanoate |
|---|---|
| PubChem CID | 118697627 |
| Molecular Formula | C34H47FN3O3+ |
| Molecular Weight | 564.77 g/mol |
| Exact Mass | 564.36 |
| IUPAC Name | [(10R,15S)-12-[4-(4-fluorophenyl)-4-oxobutyl]-4-methyl-1,4-diaza-12-azoniatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16)-trien-12-yl]methyl 2-methyl-2-propylpentanoate |
| SMILES | CCCC(C)(CCC)C(=O)OC[N+]1(CCCC(=O)c2ccc(F)cc2)CC[C@H]2[C@@H](C1)c1cccc3c1N2CCN3C |
| InChI | InChI=1S/C34H47FN3O3/c1-5-17-34(3,18-6-2)33(40)41-24-38(21-8-11-31(39)25-12-14-26(35)15-13-25)22-16-29-28(23-38)27-9-7-10-30-32(27)37(29)20-19-36(30)4/h7,9-10,12-15,28-29H,5-6,8,11,16-24H2,1-4H3/q+1/t28-,29-,38?/m0/s1 |
| InChIKey | XJZYUNBTFVGEOG-KBAQHSDHSA-N |
| XLogP | 6.54 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.77 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|