C11H17N5O — CID 86270867
6-(hexylamino)-3,7-dihydropurin-2-one (PubChem CID 86270867) has the molecular formula C11H17N5O and a molecular weight of 235.29 g/mol. Its IUPAC name is 6-(hexylamino)-3,7-dihydropurin-2-one.
| Compound Name | 6-(hexylamino)-3,7-dihydropurin-2-one |
|---|---|
| PubChem CID | 86270867 |
| Molecular Formula | C11H17N5O |
| Molecular Weight | 235.29 g/mol |
| Exact Mass | 235.14 |
| IUPAC Name | 6-(hexylamino)-3,7-dihydropurin-2-one |
| SMILES | CCCCCCNc1nc(=O)[nH]c2nc[nH]c12 |
| InChI | InChI=1S/C11H17N5O/c1-2-3-4-5-6-12-9-8-10(14-7-13-8)16-11(17)15-9/h7H,2-6H2,1H3,(H3,12,13,14,15,16,17) |
| InChIKey | XSHIHOUVADDYNX-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 86.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.29 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|