C25H17N5OS — CID 86291557
N-(7-oxo-1,3-diphenyl-1,2,4-benzotriazin-6-yl)pyridine-2-carbothioamide (PubChem CID 86291557) has the molecular formula C25H17N5OS and a molecular weight of 435.51 g/mol. Its IUPAC name is N-(7-oxo-1,3-diphenyl-1,2,4-benzotriazin-6-yl)pyridine-2-carbothioamide.
| Compound Name | N-(7-oxo-1,3-diphenyl-1,2,4-benzotriazin-6-yl)pyridine-2-carbothioamide |
|---|---|
| PubChem CID | 86291557 |
| Molecular Formula | C25H17N5OS |
| Molecular Weight | 435.51 g/mol |
| Exact Mass | 435.12 |
| IUPAC Name | N-(7-oxo-1,3-diphenyl-1,2,4-benzotriazin-6-yl)pyridine-2-carbothioamide |
| SMILES | O=c1cc2n(-c3ccccc3)nc(-c3ccccc3)nc-2cc1NC(=S)c1ccccn1 |
| InChI | InChI=1S/C25H17N5OS/c31-23-16-22-20(15-21(23)28-25(32)19-13-7-8-14-26-19)27-24(17-9-3-1-4-10-17)29-30(22)18-11-5-2-6-12-18/h1-16H,(H,28,32) |
| InChIKey | ZZRMMCUDLQPMCP-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.51 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|