C18H18BrN3S — CID 86299995
N-[4-(bromomethyl)phenyl]-2-(2-ethyl-4-pyridinyl)-4-methyl-1,3-thiazol-5-amine (PubChem CID 86299995) has the molecular formula C18H18BrN3S and a molecular weight of 388.33 g/mol. Its IUPAC name is N-[4-(bromomethyl)phenyl]-2-(2-ethyl-4-pyridinyl)-4-methyl-1,3-thiazol-5-amine.
| Compound Name | N-[4-(bromomethyl)phenyl]-2-(2-ethyl-4-pyridinyl)-4-methyl-1,3-thiazol-5-amine |
|---|---|
| PubChem CID | 86299995 |
| Molecular Formula | C18H18BrN3S |
| Molecular Weight | 388.33 g/mol |
| Exact Mass | 387.04 |
| IUPAC Name | N-[4-(bromomethyl)phenyl]-2-(2-ethyl-4-pyridinyl)-4-methyl-1,3-thiazol-5-amine |
| SMILES | CCc1cc(-c2nc(C)c(Nc3ccc(CBr)cc3)s2)ccn1 |
| InChI | InChI=1S/C18H18BrN3S/c1-3-15-10-14(8-9-20-15)18-21-12(2)17(23-18)22-16-6-4-13(11-19)5-7-16/h4-10,22H,3,11H2,1-2H3 |
| InChIKey | ZWNPQGXOGJMUIY-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.33 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|