C20H19N3O2 — CID 86342551
6-hydroxy-22-methyl-10,14,22-triazapentacyclo[12.8.0.02,10.04,9.016,21]docosa-2,4(9),5,7,16,18,20-heptaen-15-one (PubChem CID 86342551) has the molecular formula C20H19N3O2 and a molecular weight of 333.39 g/mol. Its IUPAC name is 6-hydroxy-22-methyl-10,14,22-triazapentacyclo[12.8.0.02,10.04,9.016,21]docosa-2,4(9),5,7,16,18,20-heptaen-15-one.
| Compound Name | 6-hydroxy-22-methyl-10,14,22-triazapentacyclo[12.8.0.02,10.04,9.016,21]docosa-2,4(9),5,7,16,18,20-heptaen-15-one |
|---|---|
| PubChem CID | 86342551 |
| Molecular Formula | C20H19N3O2 |
| Molecular Weight | 333.39 g/mol |
| Exact Mass | 333.15 |
| IUPAC Name | 6-hydroxy-22-methyl-10,14,22-triazapentacyclo[12.8.0.02,10.04,9.016,21]docosa-2,4(9),5,7,16,18,20-heptaen-15-one |
| SMILES | CN1c2ccccc2C(=O)N2CCCn3c(cc4cc(O)ccc43)C21 |
| InChI | InChI=1S/C20H19N3O2/c1-21-17-6-3-2-5-15(17)20(25)23-10-4-9-22-16-8-7-14(24)11-13(16)12-18(22)19(21)23/h2-3,5-8,11-12,19,24H,4,9-10H2,1H3 |
| InChIKey | HPYFSGCRQYKLIY-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 48.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.39 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |