C16H23ClN2O9S — CID 86343639
(2R,3S,4S)-1-[(2S)-2-hydroxy-2-[(4S,5R)-5-hydroxy-2-(2-nitro-4-pyridinyl)-1,3-dioxan-4-yl]ethyl]-2-(hydroxymethyl)thiolan-1-ium-3,4-diol chloride (PubChem CID 86343639) has the molecular formula C16H23ClN2O9S and a molecular weight of 454.89 g/mol. Its IUPAC name is (2R,3S,4S)-1-[(2S)-2-hydroxy-2-[(4S,5R)-5-hydroxy-2-(2-nitro-4-pyridinyl)-1,3-dioxan-4-yl]ethyl]-2-(hydroxymethyl)thiolan-1-ium-3,4-diol chloride.
| Compound Name | (2R,3S,4S)-1-[(2S)-2-hydroxy-2-[(4S,5R)-5-hydroxy-2-(2-nitro-4-pyridinyl)-1,3-dioxan-4-yl]ethyl]-2-(hydroxymethyl)thiolan-1-ium-3,4-diol chloride |
|---|---|
| PubChem CID | 86343639 |
| Molecular Formula | C16H23ClN2O9S |
| Molecular Weight | 454.89 g/mol |
| Exact Mass | 454.08 |
| IUPAC Name | (2R,3S,4S)-1-[(2S)-2-hydroxy-2-[(4S,5R)-5-hydroxy-2-(2-nitro-4-pyridinyl)-1,3-dioxan-4-yl]ethyl]-2-(hydroxymethyl)thiolan-1-ium-3,4-diol chloride |
| SMILES | O=[N+]([O-])c1cc(C2OC[C@@H](O)[C@@H]([C@H](O)C[S+]3C[C@@H](O)[C@H](O)[C@H]3CO)O2)ccn1.[Cl-] |
| InChI | InChI=1S/C16H23N2O9S.ClH/c19-4-12-14(23)10(21)6-28(12)7-11(22)15-9(20)5-26-16(27-15)8-1-2-17-13(3-8)18(24)25;/h1-3,9-12,14-16,19-23H,4-7H2;1H/q+1;/p-1/t9-,10-,11-,12-,14+,15+,16?,28?;/m1./s1 |
| InChIKey | GUOUWUQHKZYKIN-SQBVUOQUSA-M |
| XLogP | -5.16 |
| TPSA | 175.64 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.89 |
| LogP ≤ 5 | -5.16 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|