C22H24Cl2O8 — CID 22271774
1-[6-(3,4-dichlorophenyl)-2-(3,4-dimethoxyphenyl)-4,4a,8,8a-tetrahydro-[1,3]dioxino[5,4-d][1,3]dioxin-4-yl]ethane-1,2-diol (PubChem CID 22271774) has the molecular formula C22H24Cl2O8 and a molecular weight of 487.33 g/mol. Its IUPAC name is 1-[6-(3,4-dichlorophenyl)-2-(3,4-dimethoxyphenyl)-4,4a,8,8a-tetrahydro-[1,3]dioxino[5,4-d][1,3]dioxin-4-yl]ethane-1,2-diol.
| Compound Name | 1-[6-(3,4-dichlorophenyl)-2-(3,4-dimethoxyphenyl)-4,4a,8,8a-tetrahydro-[1,3]dioxino[5,4-d][1,3]dioxin-4-yl]ethane-1,2-diol |
|---|---|
| PubChem CID | 22271774 |
| Molecular Formula | C22H24Cl2O8 |
| Molecular Weight | 487.33 g/mol |
| Exact Mass | 486.08 |
| IUPAC Name | 1-[6-(3,4-dichlorophenyl)-2-(3,4-dimethoxyphenyl)-4,4a,8,8a-tetrahydro-[1,3]dioxino[5,4-d][1,3]dioxin-4-yl]ethane-1,2-diol |
| SMILES | COc1ccc(C2OC3COC(c4ccc(Cl)c(Cl)c4)OC3C(C(O)CO)O2)cc1OC |
| InChI | InChI=1S/C22H24Cl2O8/c1-27-16-6-4-12(8-17(16)28-2)22-30-18-10-29-21(11-3-5-13(23)14(24)7-11)32-20(18)19(31-22)15(26)9-25/h3-8,15,18-22,25-26H,9-10H2,1-2H3 |
| InChIKey | YPRBMPXYSKCSOD-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 95.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.33 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |