C22H24Cl2O6 — CID 18667805
1-[2-(3-chloro-4-methylphenyl)-6-(4-chloro-3-methylphenyl)-4,4a,8,8a-tetrahydro-[1,3]dioxino[5,4-d][1,3]dioxin-4-yl]ethane-1,2-diol (PubChem CID 18667805) has the molecular formula C22H24Cl2O6 and a molecular weight of 455.33 g/mol. Its IUPAC name is 1-[2-(3-chloro-4-methylphenyl)-6-(4-chloro-3-methylphenyl)-4,4a,8,8a-tetrahydro-[1,3]dioxino[5,4-d][1,3]dioxin-4-yl]ethane-1,2-diol.
| Compound Name | 1-[2-(3-chloro-4-methylphenyl)-6-(4-chloro-3-methylphenyl)-4,4a,8,8a-tetrahydro-[1,3]dioxino[5,4-d][1,3]dioxin-4-yl]ethane-1,2-diol |
|---|---|
| PubChem CID | 18667805 |
| Molecular Formula | C22H24Cl2O6 |
| Molecular Weight | 455.33 g/mol |
| Exact Mass | 454.09 |
| IUPAC Name | 1-[2-(3-chloro-4-methylphenyl)-6-(4-chloro-3-methylphenyl)-4,4a,8,8a-tetrahydro-[1,3]dioxino[5,4-d][1,3]dioxin-4-yl]ethane-1,2-diol |
| SMILES | Cc1cc(C2OCC3OC(c4ccc(C)c(Cl)c4)OC(C(O)CO)C3O2)ccc1Cl |
| InChI | InChI=1S/C22H24Cl2O6/c1-11-3-4-14(8-16(11)24)22-28-18-10-27-21(13-5-6-15(23)12(2)7-13)30-20(18)19(29-22)17(26)9-25/h3-8,17-22,25-26H,9-10H2,1-2H3 |
| InChIKey | MBZBLLSSBRLYHZ-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.33 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |