C22H22ClN2O+ — CID 8637005
[5-(3-chloro-2-methylphenyl)furan-2-yl]methyl-[2-(1H-indol-3-yl)ethyl]azanium (PubChem CID 8637005) has the molecular formula C22H22ClN2O+ and a molecular weight of 365.88 g/mol. Its IUPAC name is [5-(3-chloro-2-methylphenyl)furan-2-yl]methyl-[2-(1H-indol-3-yl)ethyl]azanium.
| Compound Name | [5-(3-chloro-2-methylphenyl)furan-2-yl]methyl-[2-(1H-indol-3-yl)ethyl]azanium |
|---|---|
| PubChem CID | 8637005 |
| Molecular Formula | C22H22ClN2O+ |
| Molecular Weight | 365.88 g/mol |
| Exact Mass | 365.14 |
| IUPAC Name | [5-(3-chloro-2-methylphenyl)furan-2-yl]methyl-[2-(1H-indol-3-yl)ethyl]azanium |
| SMILES | Cc1c(Cl)cccc1-c1ccc(C[NH2+]CCc2c[nH]c3ccccc23)o1 |
| InChI | InChI=1S/C22H21ClN2O/c1-15-18(6-4-7-20(15)23)22-10-9-17(26-22)14-24-12-11-16-13-25-21-8-3-2-5-19(16)21/h2-10,13,24-25H,11-12,14H2,1H3/p+1 |
| InChIKey | WQHIRURMHHGWCR-UHFFFAOYSA-O |
| XLogP | 4.70 |
| TPSA | 45.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.88 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|