C23H36O7 — CID 86567751
CID 86567751 (PubChem CID 86567751) has the molecular formula C23H36O7 and a molecular weight of 424.53 g/mol.
| Compound Name | CID 86567751 |
|---|---|
| PubChem CID | 86567751 |
| Molecular Formula | C23H36O7 |
| Molecular Weight | 424.53 g/mol |
| Exact Mass | 424.25 |
| IUPAC Name | — |
| SMILES | CO[C@H]1C[C@@]2(CC[C@@]3(O2)[C@H](C)[C@@H](O)C(=O)[C@H]2C(C)(C)[C@H](OC(C)=O)CC[C@@]23C)CO1 |
| InChI | InChI=1S/C23H36O7/c1-13-17(25)18(26)19-20(3,4)15(29-14(2)24)7-8-21(19,5)23(13)10-9-22(30-23)11-16(27-6)28-12-22/h13,15-17,19,25H,7-12H2,1-6H3/t13-,15-,16-,17-,19+,21+,22+,23-/m1/s1 |
| InChIKey | AVQQGOZSLGRRGA-FTYYIJPOSA-N |
| XLogP | 2.62 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.53 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |