C24H18ClN5O3S — CID 86577762
N-[(E)-(4-chlorophenyl)methylideneamino]-2-(5,5-dioxo-3-phenyl-1H-pyrazolo[4,3-c][1,2]benzothiazin-4-yl)acetamide (PubChem CID 86577762) has the molecular formula C24H18ClN5O3S and a molecular weight of 491.96 g/mol. Its IUPAC name is N-[(E)-(4-chlorophenyl)methylideneamino]-2-(5,5-dioxo-3-phenyl-1H-pyrazolo[4,3-c][1,2]benzothiazin-4-yl)acetamide.
| Compound Name | N-[(E)-(4-chlorophenyl)methylideneamino]-2-(5,5-dioxo-3-phenyl-1H-pyrazolo[4,3-c][1,2]benzothiazin-4-yl)acetamide |
|---|---|
| PubChem CID | 86577762 |
| Molecular Formula | C24H18ClN5O3S |
| Molecular Weight | 491.96 g/mol |
| Exact Mass | 491.08 |
| IUPAC Name | N-[(E)-(4-chlorophenyl)methylideneamino]-2-(5,5-dioxo-3-phenyl-1H-pyrazolo[4,3-c][1,2]benzothiazin-4-yl)acetamide |
| SMILES | O=C(CN1c2c(-c3ccccc3)n[nH]c2-c2ccccc2S1(=O)=O)N/N=C/c1ccc(Cl)cc1 |
| InChI | InChI=1S/C24H18ClN5O3S/c25-18-12-10-16(11-13-18)14-26-27-21(31)15-30-24-22(17-6-2-1-3-7-17)28-29-23(24)19-8-4-5-9-20(19)34(30,32)33/h1-14H,15H2,(H,27,31)(H,28,29)/b26-14+ |
| InChIKey | CGAFOJPBNILHND-VULFUBBASA-N |
| XLogP | 4.06 |
| TPSA | 107.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.96 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|