C25H20ClN5O3S — CID 86580095
N-[(E)-(4-chlorophenyl)methylideneamino]-2-(4-methyl-5,5-dioxo-3-phenylpyrazolo[4,3-c][1,2]benzothiazin-1-yl)acetamide (PubChem CID 86580095) has the molecular formula C25H20ClN5O3S and a molecular weight of 505.99 g/mol. Its IUPAC name is N-[(E)-(4-chlorophenyl)methylideneamino]-2-(4-methyl-5,5-dioxo-3-phenylpyrazolo[4,3-c][1,2]benzothiazin-1-yl)acetamide.
| Compound Name | N-[(E)-(4-chlorophenyl)methylideneamino]-2-(4-methyl-5,5-dioxo-3-phenylpyrazolo[4,3-c][1,2]benzothiazin-1-yl)acetamide |
|---|---|
| PubChem CID | 86580095 |
| Molecular Formula | C25H20ClN5O3S |
| Molecular Weight | 505.99 g/mol |
| Exact Mass | 505.10 |
| IUPAC Name | N-[(E)-(4-chlorophenyl)methylideneamino]-2-(4-methyl-5,5-dioxo-3-phenylpyrazolo[4,3-c][1,2]benzothiazin-1-yl)acetamide |
| SMILES | CN1c2c(-c3ccccc3)nn(CC(=O)N/N=C/c3ccc(Cl)cc3)c2-c2ccccc2S1(=O)=O |
| InChI | InChI=1S/C25H20ClN5O3S/c1-30-25-23(18-7-3-2-4-8-18)29-31(24(25)20-9-5-6-10-21(20)35(30,33)34)16-22(32)28-27-15-17-11-13-19(26)14-12-17/h2-15H,16H2,1H3,(H,28,32)/b27-15+ |
| InChIKey | NLRKXKGAHLRYGT-JFLMPSFJSA-N |
| XLogP | 4.16 |
| TPSA | 96.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.99 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|