C24H17Cl2N5O3S — CID 86577763
N-[(E)-(2,4-dichlorophenyl)methylideneamino]-2-(5,5-dioxo-3-phenyl-1H-pyrazolo[4,3-c][1,2]benzothiazin-4-yl)acetamide (PubChem CID 86577763) has the molecular formula C24H17Cl2N5O3S and a molecular weight of 526.41 g/mol. Its IUPAC name is N-[(E)-(2,4-dichlorophenyl)methylideneamino]-2-(5,5-dioxo-3-phenyl-1H-pyrazolo[4,3-c][1,2]benzothiazin-4-yl)acetamide.
| Compound Name | N-[(E)-(2,4-dichlorophenyl)methylideneamino]-2-(5,5-dioxo-3-phenyl-1H-pyrazolo[4,3-c][1,2]benzothiazin-4-yl)acetamide |
|---|---|
| PubChem CID | 86577763 |
| Molecular Formula | C24H17Cl2N5O3S |
| Molecular Weight | 526.41 g/mol |
| Exact Mass | 525.04 |
| IUPAC Name | N-[(E)-(2,4-dichlorophenyl)methylideneamino]-2-(5,5-dioxo-3-phenyl-1H-pyrazolo[4,3-c][1,2]benzothiazin-4-yl)acetamide |
| SMILES | O=C(CN1c2c(-c3ccccc3)n[nH]c2-c2ccccc2S1(=O)=O)N/N=C/c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C24H17Cl2N5O3S/c25-17-11-10-16(19(26)12-17)13-27-28-21(32)14-31-24-22(15-6-2-1-3-7-15)29-30-23(24)18-8-4-5-9-20(18)35(31,33)34/h1-13H,14H2,(H,28,32)(H,29,30)/b27-13+ |
| InChIKey | BTUHKGSPGSSSCB-UVHMKAGCSA-N |
| XLogP | 4.71 |
| TPSA | 107.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.41 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|