C20H17Cl2N5O3S — CID 45112802
N-[(E)-(2,4-dichlorophenyl)methylideneamino]-2-(3,4-dimethyl-5,5-dioxopyrazolo[4,3-c][1,2]benzothiazin-2-yl)acetamide (PubChem CID 45112802) has the molecular formula C20H17Cl2N5O3S and a molecular weight of 478.36 g/mol. Its IUPAC name is N-[(E)-(2,4-dichlorophenyl)methylideneamino]-2-(3,4-dimethyl-5,5-dioxopyrazolo[4,3-c][1,2]benzothiazin-2-yl)acetamide.
| Compound Name | N-[(E)-(2,4-dichlorophenyl)methylideneamino]-2-(3,4-dimethyl-5,5-dioxopyrazolo[4,3-c][1,2]benzothiazin-2-yl)acetamide |
|---|---|
| PubChem CID | 45112802 |
| Molecular Formula | C20H17Cl2N5O3S |
| Molecular Weight | 478.36 g/mol |
| Exact Mass | 477.04 |
| IUPAC Name | N-[(E)-(2,4-dichlorophenyl)methylideneamino]-2-(3,4-dimethyl-5,5-dioxopyrazolo[4,3-c][1,2]benzothiazin-2-yl)acetamide |
| SMILES | Cc1c2c(nn1CC(=O)N/N=C/c1ccc(Cl)cc1Cl)-c1ccccc1S(=O)(=O)N2C |
| InChI | InChI=1S/C20H17Cl2N5O3S/c1-12-20-19(15-5-3-4-6-17(15)31(29,30)26(20)2)25-27(12)11-18(28)24-23-10-13-7-8-14(21)9-16(13)22/h3-10H,11H2,1-2H3,(H,24,28)/b23-10+ |
| InChIKey | IUAHRTAUWRYPGG-AUEPDCJTSA-N |
| XLogP | 3.45 |
| TPSA | 96.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.36 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|