C25H20N6O5S — CID 86580117
2-(4-methyl-5,5-dioxo-3-phenylpyrazolo[4,3-c][1,2]benzothiazin-1-yl)-N-[(E)-(2-nitrophenyl)methylideneamino]acetamide (PubChem CID 86580117) has the molecular formula C25H20N6O5S and a molecular weight of 516.54 g/mol. Its IUPAC name is 2-(4-methyl-5,5-dioxo-3-phenylpyrazolo[4,3-c][1,2]benzothiazin-1-yl)-N-[(E)-(2-nitrophenyl)methylideneamino]acetamide.
| Compound Name | 2-(4-methyl-5,5-dioxo-3-phenylpyrazolo[4,3-c][1,2]benzothiazin-1-yl)-N-[(E)-(2-nitrophenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 86580117 |
| Molecular Formula | C25H20N6O5S |
| Molecular Weight | 516.54 g/mol |
| Exact Mass | 516.12 |
| IUPAC Name | 2-(4-methyl-5,5-dioxo-3-phenylpyrazolo[4,3-c][1,2]benzothiazin-1-yl)-N-[(E)-(2-nitrophenyl)methylideneamino]acetamide |
| SMILES | CN1c2c(-c3ccccc3)nn(CC(=O)N/N=C/c3ccccc3[N+](=O)[O-])c2-c2ccccc2S1(=O)=O |
| InChI | InChI=1S/C25H20N6O5S/c1-29-25-23(17-9-3-2-4-10-17)28-30(24(25)19-12-6-8-14-21(19)37(29,35)36)16-22(32)27-26-15-18-11-5-7-13-20(18)31(33)34/h2-15H,16H2,1H3,(H,27,32)/b26-15+ |
| InChIKey | CJMFLLWZANSOLF-CVKSISIWSA-N |
| XLogP | 3.41 |
| TPSA | 139.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.54 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|