C22H18N6O5 — CID 46907378
2-(7-benzyl-3-methyl-4-oxo-[1,2]oxazolo[4,5-d]pyridazin-5-yl)-N-[(Z)-(2-nitrophenyl)methylideneamino]acetamide (PubChem CID 46907378) has the molecular formula C22H18N6O5 and a molecular weight of 446.42 g/mol. Its IUPAC name is 2-(7-benzyl-3-methyl-4-oxo-[1,2]oxazolo[4,5-d]pyridazin-5-yl)-N-[(Z)-(2-nitrophenyl)methylideneamino]acetamide.
| Compound Name | 2-(7-benzyl-3-methyl-4-oxo-[1,2]oxazolo[4,5-d]pyridazin-5-yl)-N-[(Z)-(2-nitrophenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 46907378 |
| Molecular Formula | C22H18N6O5 |
| Molecular Weight | 446.42 g/mol |
| Exact Mass | 446.13 |
| IUPAC Name | 2-(7-benzyl-3-methyl-4-oxo-[1,2]oxazolo[4,5-d]pyridazin-5-yl)-N-[(Z)-(2-nitrophenyl)methylideneamino]acetamide |
| SMILES | Cc1noc2c(Cc3ccccc3)nn(CC(=O)N/N=C\c3ccccc3[N+](=O)[O-])c(=O)c12 |
| InChI | InChI=1S/C22H18N6O5/c1-14-20-21(33-26-14)17(11-15-7-3-2-4-8-15)25-27(22(20)30)13-19(29)24-23-12-16-9-5-6-10-18(16)28(31)32/h2-10,12H,11,13H2,1H3,(H,24,29)/b23-12- |
| InChIKey | AMXSQOWILBBAGC-FMCGGJTJSA-N |
| XLogP | 2.34 |
| TPSA | 145.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.42 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|