C20H18N6O5S — CID 45112680
2-(3,4-dimethyl-5,5-dioxopyrazolo[4,3-c][1,2]benzothiazin-2-yl)-N-[(E)-(4-nitrophenyl)methylideneamino]acetamide (PubChem CID 45112680) has the molecular formula C20H18N6O5S and a molecular weight of 454.47 g/mol. Its IUPAC name is 2-(3,4-dimethyl-5,5-dioxopyrazolo[4,3-c][1,2]benzothiazin-2-yl)-N-[(E)-(4-nitrophenyl)methylideneamino]acetamide.
| Compound Name | 2-(3,4-dimethyl-5,5-dioxopyrazolo[4,3-c][1,2]benzothiazin-2-yl)-N-[(E)-(4-nitrophenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 45112680 |
| Molecular Formula | C20H18N6O5S |
| Molecular Weight | 454.47 g/mol |
| Exact Mass | 454.11 |
| IUPAC Name | 2-(3,4-dimethyl-5,5-dioxopyrazolo[4,3-c][1,2]benzothiazin-2-yl)-N-[(E)-(4-nitrophenyl)methylideneamino]acetamide |
| SMILES | Cc1c2c(nn1CC(=O)N/N=C/c1ccc([N+](=O)[O-])cc1)-c1ccccc1S(=O)(=O)N2C |
| InChI | InChI=1S/C20H18N6O5S/c1-13-20-19(16-5-3-4-6-17(16)32(30,31)24(20)2)23-25(13)12-18(27)22-21-11-14-7-9-15(10-8-14)26(28)29/h3-11H,12H2,1-2H3,(H,22,27)/b21-11+ |
| InChIKey | VZYASEXUSNDZBG-SRZZPIQSSA-N |
| XLogP | 2.06 |
| TPSA | 139.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.47 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|