C31H29F2N7O4 — CID 86579789
(E)-N-[2-(1,3-benzodioxol-5-yl)ethyl]-3-phenylprop-2-enamide;2-(2,4-difluorophenyl)-1,3-bis(1,2,4-triazol-1-yl)propan-2-ol (PubChem CID 86579789) has the molecular formula C31H29F2N7O4 and a molecular weight of 601.61 g/mol. Its IUPAC name is (E)-N-[2-(1,3-benzodioxol-5-yl)ethyl]-3-phenylprop-2-enamide;2-(2,4-difluorophenyl)-1,3-bis(1,2,4-triazol-1-yl)propan-2-ol.
| Compound Name | (E)-N-[2-(1,3-benzodioxol-5-yl)ethyl]-3-phenylprop-2-enamide;2-(2,4-difluorophenyl)-1,3-bis(1,2,4-triazol-1-yl)propan-2-ol |
|---|---|
| PubChem CID | 86579789 |
| Molecular Formula | C31H29F2N7O4 |
| Molecular Weight | 601.61 g/mol |
| Exact Mass | 601.22 |
| IUPAC Name | (E)-N-[2-(1,3-benzodioxol-5-yl)ethyl]-3-phenylprop-2-enamide;2-(2,4-difluorophenyl)-1,3-bis(1,2,4-triazol-1-yl)propan-2-ol |
| SMILES | O=C(/C=C/c1ccccc1)NCCc1ccc2c(c1)OCO2.OC(Cn1cncn1)(Cn1cncn1)c1ccc(F)cc1F |
| InChI | InChI=1S/C18H17NO3.C13H12F2N6O/c20-18(9-7-14-4-2-1-3-5-14)19-11-10-15-6-8-16-17(12-15)22-13-21-16;14-10-1-2-11(12(15)3-10)13(22,4-20-8-16-6-18-20)5-21-9-17-7-19-21/h1-9,12H,10-11,13H2,(H,19,20);1-3,6-9,22H,4-5H2/b9-7+; |
| InChIKey | PMNYNIULRCKVSD-BXTVWIJMSA-N |
| XLogP | 3.52 |
| TPSA | 129.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.61 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|