C29H26F3N7O4 — CID 86579626
N-[2-(1,3-benzodioxol-5-yl)ethyl]-4-fluorobenzamide;2-(2,4-difluorophenyl)-1,3-bis(1,2,4-triazol-1-yl)propan-2-ol (PubChem CID 86579626) has the molecular formula C29H26F3N7O4 and a molecular weight of 593.57 g/mol. Its IUPAC name is N-[2-(1,3-benzodioxol-5-yl)ethyl]-4-fluorobenzamide;2-(2,4-difluorophenyl)-1,3-bis(1,2,4-triazol-1-yl)propan-2-ol.
| Compound Name | N-[2-(1,3-benzodioxol-5-yl)ethyl]-4-fluorobenzamide;2-(2,4-difluorophenyl)-1,3-bis(1,2,4-triazol-1-yl)propan-2-ol |
|---|---|
| PubChem CID | 86579626 |
| Molecular Formula | C29H26F3N7O4 |
| Molecular Weight | 593.57 g/mol |
| Exact Mass | 593.20 |
| IUPAC Name | N-[2-(1,3-benzodioxol-5-yl)ethyl]-4-fluorobenzamide;2-(2,4-difluorophenyl)-1,3-bis(1,2,4-triazol-1-yl)propan-2-ol |
| SMILES | O=C(NCCc1ccc2c(c1)OCO2)c1ccc(F)cc1.OC(Cn1cncn1)(Cn1cncn1)c1ccc(F)cc1F |
| InChI | InChI=1S/C16H14FNO3.C13H12F2N6O/c17-13-4-2-12(3-5-13)16(19)18-8-7-11-1-6-14-15(9-11)21-10-20-14;14-10-1-2-11(12(15)3-10)13(22,4-20-8-16-6-18-20)5-21-9-17-7-19-21/h1-6,9H,7-8,10H2,(H,18,19);1-3,6-9,22H,4-5H2 |
| InChIKey | UNOLVNCUJCFLFF-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 129.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.57 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |