C13H14N2O5 — CID 86584642
ethyl 1-(4-methoxyphenyl)-4,5-dioxopyrazolidine-3-carboxylate (PubChem CID 86584642) has the molecular formula C13H14N2O5 and a molecular weight of 278.26 g/mol. Its IUPAC name is ethyl 1-(4-methoxyphenyl)-4,5-dioxopyrazolidine-3-carboxylate.
| Compound Name | ethyl 1-(4-methoxyphenyl)-4,5-dioxopyrazolidine-3-carboxylate |
|---|---|
| PubChem CID | 86584642 |
| Molecular Formula | C13H14N2O5 |
| Molecular Weight | 278.26 g/mol |
| Exact Mass | 278.09 |
| IUPAC Name | ethyl 1-(4-methoxyphenyl)-4,5-dioxopyrazolidine-3-carboxylate |
| SMILES | CCOC(=O)C1NN(c2ccc(OC)cc2)C(=O)C1=O |
| InChI | InChI=1S/C13H14N2O5/c1-3-20-13(18)10-11(16)12(17)15(14-10)8-4-6-9(19-2)7-5-8/h4-7,10,14H,3H2,1-2H3 |
| InChIKey | OTUXSDUDLXTBPW-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.26 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|