C21H29NNaO7S — CID 86585507
CID 86585507 (PubChem CID 86585507) has the molecular formula C21H29NNaO7S and a molecular weight of 462.52 g/mol.
| Compound Name | CID 86585507 |
|---|---|
| PubChem CID | 86585507 |
| Molecular Formula | C21H29NNaO7S |
| Molecular Weight | 462.52 g/mol |
| Exact Mass | 462.16 |
| IUPAC Name | — |
| SMILES | CCOC(=O)C1=C[C@@H](OC(CC)CC)[C@@H](O)[C@H](/N=C/c2ccccc2S(=O)(=O)O)C1.[Na] |
| InChI | InChI=1S/C21H29NO7S.Na/c1-4-16(5-2)29-18-12-15(21(24)28-6-3)11-17(20(18)23)22-13-14-9-7-8-10-19(14)30(25,26)27;/h7-10,12-13,16-18,20,23H,4-6,11H2,1-3H3,(H,25,26,27);/b22-13+;/t17-,18-,20+;/m1./s1 |
| InChIKey | HIQGAWRFTAIBBK-OSXIIFAQSA-N |
| XLogP | 2.17 |
| TPSA | 122.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.52 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|