C18H21N3O2S — CID 8658586
1-(1,3-benzodioxol-5-yl)-3-butyl-1-(pyridin-4-ylmethyl)thiourea (PubChem CID 8658586) has the molecular formula C18H21N3O2S and a molecular weight of 343.45 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-yl)-3-butyl-1-(pyridin-4-ylmethyl)thiourea.
| Compound Name | 1-(1,3-benzodioxol-5-yl)-3-butyl-1-(pyridin-4-ylmethyl)thiourea |
|---|---|
| PubChem CID | 8658586 |
| Molecular Formula | C18H21N3O2S |
| Molecular Weight | 343.45 g/mol |
| Exact Mass | 343.14 |
| IUPAC Name | 1-(1,3-benzodioxol-5-yl)-3-butyl-1-(pyridin-4-ylmethyl)thiourea |
| SMILES | CCCCNC(=S)N(Cc1ccncc1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C18H21N3O2S/c1-2-3-8-20-18(24)21(12-14-6-9-19-10-7-14)15-4-5-16-17(11-15)23-13-22-16/h4-7,9-11H,2-3,8,12-13H2,1H3,(H,20,24) |
| InChIKey | HADSZEHQSJZSHU-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 46.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.45 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|