C27H38N2O4 — CID 86591426
8-(6,7-dimethoxy-3-methyl-3,4-dihydro-1H-isoquinolin-2-yl)-N-phenylmethoxyoctanamide (PubChem CID 86591426) has the molecular formula C27H38N2O4 and a molecular weight of 454.61 g/mol. Its IUPAC name is 8-(6,7-dimethoxy-3-methyl-3,4-dihydro-1H-isoquinolin-2-yl)-N-phenylmethoxyoctanamide.
| Compound Name | 8-(6,7-dimethoxy-3-methyl-3,4-dihydro-1H-isoquinolin-2-yl)-N-phenylmethoxyoctanamide |
|---|---|
| PubChem CID | 86591426 |
| Molecular Formula | C27H38N2O4 |
| Molecular Weight | 454.61 g/mol |
| Exact Mass | 454.28 |
| IUPAC Name | 8-(6,7-dimethoxy-3-methyl-3,4-dihydro-1H-isoquinolin-2-yl)-N-phenylmethoxyoctanamide |
| SMILES | COc1cc2c(cc1OC)CN(CCCCCCCC(=O)NOCc1ccccc1)C(C)C2 |
| InChI | InChI=1S/C27H38N2O4/c1-21-16-23-17-25(31-2)26(32-3)18-24(23)19-29(21)15-11-6-4-5-10-14-27(30)28-33-20-22-12-8-7-9-13-22/h7-9,12-13,17-18,21H,4-6,10-11,14-16,19-20H2,1-3H3,(H,28,30) |
| InChIKey | ANCTYVQSMJOSGQ-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.61 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|