About 6-[6-(3,5-dimethylphenyl)-3-oxo-1H-isoindol-2-yl]-N-phenylmethoxyhexanamide
6-[6-(3,5-dimethylphenyl)-3-oxo-1H-isoindol-2-yl]-N-phenylmethoxyhexanamide (PubChem CID 87109609) has the molecular formula C29H32N2O3
and a molecular weight of 456.59 g/mol. Its IUPAC name is 6-[6-(3,5-dimethylphenyl)-3-oxo-1H-isoindol-2-yl]-N-phenylmethoxyhexanamide.
Molecular Properties
| Compound Name | 6-[6-(3,5-dimethylphenyl)-3-oxo-1H-isoindol-2-yl]-N-phenylmethoxyhexanamide |
| PubChem CID | 87109609 |
| Molecular Formula | C29H32N2O3 |
| Molecular Weight | 456.59 g/mol |
| Exact Mass | 456.24 |
| IUPAC Name | 6-[6-(3,5-dimethylphenyl)-3-oxo-1H-isoindol-2-yl]-N-phenylmethoxyhexanamide |
| SMILES | Cc1cc(C)cc(-c2ccc3c(c2)CN(CCCCCC(=O)NOCc2ccccc2)C3=O)c1 |
| InChI | InChI=1S/C29H32N2O3/c1-21-15-22(2)17-25(16-21)24-12-13-27-26(18-24)19-31(29(27)33)14-8-4-7-11-28(32)30-34-20-23-9-5-3-6-10-23/h3,5-6,9-10,12-13,15-18H,4,7-8,11,14,19-20H2,1-2H3,(H,30,32) |
| InChIKey | HGFKOWXXNIUXBX-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 456.59 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 6-[6-(3,5-dimethylphenyl)-3-oxo-1H-isoindol-2-yl]-N-phenylmethoxyhexanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[6-(3,5-dimethylphenyl)-3-oxo-1H-isoindol-2-yl]-N-phenylmethoxyhexanamide?
The IUPAC name of 6-[6-(3,5-dimethylphenyl)-3-oxo-1H-isoindol-2-yl]-N-phenylmethoxyhexanamide (CID 87109609) is 6-[6-(3,5-dimethylphenyl)-3-oxo-1H-isoindol-2-yl]-N-phenylmethoxyhexanamide.
What is the SMILES notation for 6-[6-(3,5-dimethylphenyl)-3-oxo-1H-isoindol-2-yl]-N-phenylmethoxyhexanamide?
The canonical SMILES for 6-[6-(3,5-dimethylphenyl)-3-oxo-1H-isoindol-2-yl]-N-phenylmethoxyhexanamide is Cc1cc(C)cc(-c2ccc3c(c2)CN(CCCCCC(=O)NOCc2ccccc2)C3=O)c1.
What is the InChIKey of 6-[6-(3,5-dimethylphenyl)-3-oxo-1H-isoindol-2-yl]-N-phenylmethoxyhexanamide?
The InChIKey is HGFKOWXXNIUXBX-UHFFFAOYSA-N. The full InChI is InChI=1S/C29H32N2O3/c1-21-15-22(2)17-25(16-21)24-12-13-27-26(18-24)19-31(29(27)33)14-8-4-7-11-28(32)30-34-20-23-9-5-3-6-10-23/h3,5-6,9-10,12-13,15-18H,4,7-8,11,14,19-20H2,1-2H3,(H,30,32).
What are the key properties of 6-[6-(3,5-dimethylphenyl)-3-oxo-1H-isoindol-2-yl]-N-phenylmethoxyhexanamide?
6-[6-(3,5-dimethylphenyl)-3-oxo-1H-isoindol-2-yl]-N-phenylmethoxyhexanamide has a molecular weight of 456.59 g/mol, XLogP of 5.73, 10 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[6-(3,5-dimethylphenyl)-3-oxo-1H-isoindol-2-yl]-N-phenylmethoxyhexanamide is sourced from PubChem (CID 87109609), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).