About 1-[(5-bromo-3-pyridinyl)methyl]pyrido[2,3-d][1,3]oxazine-2,4-dione
1-[(5-bromo-3-pyridinyl)methyl]pyrido[2,3-d][1,3]oxazine-2,4-dione (PubChem CID 86592102) has the molecular formula C13H8BrN3O3
and a molecular weight of 334.13 g/mol. Its IUPAC name is 1-[(5-bromo-3-pyridinyl)methyl]pyrido[2,3-d][1,3]oxazine-2,4-dione.
Molecular Properties
| Compound Name | 1-[(5-bromo-3-pyridinyl)methyl]pyrido[2,3-d][1,3]oxazine-2,4-dione |
| PubChem CID | 86592102 |
| Molecular Formula | C13H8BrN3O3 |
| Molecular Weight | 334.13 g/mol |
| Exact Mass | 332.97 |
| IUPAC Name | 1-[(5-bromo-3-pyridinyl)methyl]pyrido[2,3-d][1,3]oxazine-2,4-dione |
| SMILES | O=c1oc(=O)n(Cc2cncc(Br)c2)c2ncccc12 |
| InChI | InChI=1S/C13H8BrN3O3/c14-9-4-8(5-15-6-9)7-17-11-10(2-1-3-16-11)12(18)20-13(17)19/h1-6H,7H2 |
| InChIKey | FPYSIBDHANGPAS-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 77.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.13 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-[(5-bromo-3-pyridinyl)methyl]pyrido[2,3-d][1,3]oxazine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(5-bromo-3-pyridinyl)methyl]pyrido[2,3-d][1,3]oxazine-2,4-dione?
The IUPAC name of 1-[(5-bromo-3-pyridinyl)methyl]pyrido[2,3-d][1,3]oxazine-2,4-dione (CID 86592102) is 1-[(5-bromo-3-pyridinyl)methyl]pyrido[2,3-d][1,3]oxazine-2,4-dione.
What is the SMILES notation for 1-[(5-bromo-3-pyridinyl)methyl]pyrido[2,3-d][1,3]oxazine-2,4-dione?
The canonical SMILES for 1-[(5-bromo-3-pyridinyl)methyl]pyrido[2,3-d][1,3]oxazine-2,4-dione is O=c1oc(=O)n(Cc2cncc(Br)c2)c2ncccc12.
What is the InChIKey of 1-[(5-bromo-3-pyridinyl)methyl]pyrido[2,3-d][1,3]oxazine-2,4-dione?
The InChIKey is FPYSIBDHANGPAS-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H8BrN3O3/c14-9-4-8(5-15-6-9)7-17-11-10(2-1-3-16-11)12(18)20-13(17)19/h1-6H,7H2.
What are the key properties of 1-[(5-bromo-3-pyridinyl)methyl]pyrido[2,3-d][1,3]oxazine-2,4-dione?
1-[(5-bromo-3-pyridinyl)methyl]pyrido[2,3-d][1,3]oxazine-2,4-dione has a molecular weight of 334.13 g/mol, XLogP of 1.56, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(5-bromo-3-pyridinyl)methyl]pyrido[2,3-d][1,3]oxazine-2,4-dione is sourced from PubChem (CID 86592102), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).