C17H11N3O5 — CID 87254927
1-[2-(1,3-dioxoisoindol-2-yl)ethyl]pyrido[2,3-d][1,3]oxazine-2,4-dione (PubChem CID 87254927) has the molecular formula C17H11N3O5 and a molecular weight of 337.29 g/mol. Its IUPAC name is 1-[2-(1,3-dioxoisoindol-2-yl)ethyl]pyrido[2,3-d][1,3]oxazine-2,4-dione.
| Compound Name | 1-[2-(1,3-dioxoisoindol-2-yl)ethyl]pyrido[2,3-d][1,3]oxazine-2,4-dione |
|---|---|
| PubChem CID | 87254927 |
| Molecular Formula | C17H11N3O5 |
| Molecular Weight | 337.29 g/mol |
| Exact Mass | 337.07 |
| IUPAC Name | 1-[2-(1,3-dioxoisoindol-2-yl)ethyl]pyrido[2,3-d][1,3]oxazine-2,4-dione |
| SMILES | O=C1c2ccccc2C(=O)N1CCn1c(=O)oc(=O)c2cccnc21 |
| InChI | InChI=1S/C17H11N3O5/c21-14-10-4-1-2-5-11(10)15(22)20(14)9-8-19-13-12(6-3-7-18-13)16(23)25-17(19)24/h1-7H,8-9H2 |
| InChIKey | YIKGTQIORYGCFY-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 102.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.29 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|