C18H22ClNO5 — CID 86596926
tert-butyl N-[3-(5-chloro-2-oxochromen-4-yl)oxybutyl]carbamate (PubChem CID 86596926) has the molecular formula C18H22ClNO5 and a molecular weight of 367.83 g/mol. Its IUPAC name is tert-butyl N-[3-(5-chloro-2-oxochromen-4-yl)oxybutyl]carbamate.
| Compound Name | tert-butyl N-[3-(5-chloro-2-oxochromen-4-yl)oxybutyl]carbamate |
|---|---|
| PubChem CID | 86596926 |
| Molecular Formula | C18H22ClNO5 |
| Molecular Weight | 367.83 g/mol |
| Exact Mass | 367.12 |
| IUPAC Name | tert-butyl N-[3-(5-chloro-2-oxochromen-4-yl)oxybutyl]carbamate |
| SMILES | CC(CCNC(=O)OC(C)(C)C)Oc1cc(=O)oc2cccc(Cl)c12 |
| InChI | InChI=1S/C18H22ClNO5/c1-11(8-9-20-17(22)25-18(2,3)4)23-14-10-15(21)24-13-7-5-6-12(19)16(13)14/h5-7,10-11H,8-9H2,1-4H3,(H,20,22) |
| InChIKey | PKCJHTDCFDGGKY-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 77.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.83 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|