C22H24F3N3O — CID 86600064
1-[(6R,9aR)-6-benzhydryl-1,3,4,6,7,8,9,9a-octahydropyrazino[1,2-a]pyrazin-2-yl]-2,2,2-trifluoroethanone (PubChem CID 86600064) has the molecular formula C22H24F3N3O and a molecular weight of 403.45 g/mol. Its IUPAC name is 1-[(6R,9aR)-6-benzhydryl-1,3,4,6,7,8,9,9a-octahydropyrazino[1,2-a]pyrazin-2-yl]-2,2,2-trifluoroethanone.
| Compound Name | 1-[(6R,9aR)-6-benzhydryl-1,3,4,6,7,8,9,9a-octahydropyrazino[1,2-a]pyrazin-2-yl]-2,2,2-trifluoroethanone |
|---|---|
| PubChem CID | 86600064 |
| Molecular Formula | C22H24F3N3O |
| Molecular Weight | 403.45 g/mol |
| Exact Mass | 403.19 |
| IUPAC Name | 1-[(6R,9aR)-6-benzhydryl-1,3,4,6,7,8,9,9a-octahydropyrazino[1,2-a]pyrazin-2-yl]-2,2,2-trifluoroethanone |
| SMILES | O=C(N1CCN2[C@H](CNC[C@H]2C(c2ccccc2)c2ccccc2)C1)C(F)(F)F |
| InChI | InChI=1S/C22H24F3N3O/c23-22(24,25)21(29)27-11-12-28-18(15-27)13-26-14-19(28)20(16-7-3-1-4-8-16)17-9-5-2-6-10-17/h1-10,18-20,26H,11-15H2/t18-,19+/m1/s1 |
| InChIKey | ZWXWFFASYSQXJJ-MOPGFXCFSA-N |
| XLogP | 2.87 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.45 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |