C19H22O7S — CID 86605511
2-[4-[2,6-dimethyl-4-(2-methylsulfonyloxyethoxy)phenyl]phenoxy]acetic acid (PubChem CID 86605511) has the molecular formula C19H22O7S and a molecular weight of 394.45 g/mol. Its IUPAC name is 2-[4-[2,6-dimethyl-4-(2-methylsulfonyloxyethoxy)phenyl]phenoxy]acetic acid.
| Compound Name | 2-[4-[2,6-dimethyl-4-(2-methylsulfonyloxyethoxy)phenyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 86605511 |
| Molecular Formula | C19H22O7S |
| Molecular Weight | 394.45 g/mol |
| Exact Mass | 394.11 |
| IUPAC Name | 2-[4-[2,6-dimethyl-4-(2-methylsulfonyloxyethoxy)phenyl]phenoxy]acetic acid |
| SMILES | Cc1cc(OCCOS(C)(=O)=O)cc(C)c1-c1ccc(OCC(=O)O)cc1 |
| InChI | InChI=1S/C19H22O7S/c1-13-10-17(24-8-9-26-27(3,22)23)11-14(2)19(13)15-4-6-16(7-5-15)25-12-18(20)21/h4-7,10-11H,8-9,12H2,1-3H3,(H,20,21) |
| InChIKey | KWBVMOWNRIHFAR-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.45 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|