C25H26BrN5OS — CID 86606467
2-[(4-bromophenyl)carbamothioylamino]-2-phenyl-N-(4-pyrrolidin-1-yliminocyclohexa-1,5-dien-1-yl)acetamide (PubChem CID 86606467) has the molecular formula C25H26BrN5OS and a molecular weight of 524.49 g/mol. Its IUPAC name is 2-[(4-bromophenyl)carbamothioylamino]-2-phenyl-N-(4-pyrrolidin-1-yliminocyclohexa-1,5-dien-1-yl)acetamide.
| Compound Name | 2-[(4-bromophenyl)carbamothioylamino]-2-phenyl-N-(4-pyrrolidin-1-yliminocyclohexa-1,5-dien-1-yl)acetamide |
|---|---|
| PubChem CID | 86606467 |
| Molecular Formula | C25H26BrN5OS |
| Molecular Weight | 524.49 g/mol |
| Exact Mass | 523.10 |
| IUPAC Name | 2-[(4-bromophenyl)carbamothioylamino]-2-phenyl-N-(4-pyrrolidin-1-yliminocyclohexa-1,5-dien-1-yl)acetamide |
| SMILES | O=C(NC1=CCC(=NN2CCCC2)C=C1)C(NC(=S)Nc1ccc(Br)cc1)c1ccccc1 |
| InChI | InChI=1S/C25H26BrN5OS/c26-19-8-10-21(11-9-19)28-25(33)29-23(18-6-2-1-3-7-18)24(32)27-20-12-14-22(15-13-20)30-31-16-4-5-17-31/h1-3,6-14,23H,4-5,15-17H2,(H,27,32)(H2,28,29,33) |
| InChIKey | IAJXDFLZCCAURD-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.49 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|