C29H30N4O3 — CID 86610143
9H-fluoren-9-ylmethyl N-[(2S)-6-amino-1-(1H-indol-4-ylamino)-1-oxohexan-2-yl]carbamate (PubChem CID 86610143) has the molecular formula C29H30N4O3 and a molecular weight of 482.58 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[(2S)-6-amino-1-(1H-indol-4-ylamino)-1-oxohexan-2-yl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[(2S)-6-amino-1-(1H-indol-4-ylamino)-1-oxohexan-2-yl]carbamate |
|---|---|
| PubChem CID | 86610143 |
| Molecular Formula | C29H30N4O3 |
| Molecular Weight | 482.58 g/mol |
| Exact Mass | 482.23 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[(2S)-6-amino-1-(1H-indol-4-ylamino)-1-oxohexan-2-yl]carbamate |
| SMILES | NCCCC[C@H](NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)Nc1cccc2[nH]ccc12 |
| InChI | InChI=1S/C29H30N4O3/c30-16-6-5-12-27(28(34)32-26-14-7-13-25-23(26)15-17-31-25)33-29(35)36-18-24-21-10-3-1-8-19(21)20-9-2-4-11-22(20)24/h1-4,7-11,13-15,17,24,27,31H,5-6,12,16,18,30H2,(H,32,34)(H,33,35)/t27-/m0/s1 |
| InChIKey | OVOUYMCUSFGWQR-MHZLTWQESA-N |
| XLogP | 5.14 |
| TPSA | 109.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.58 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|