C15H22ClN3O5S — CID 86610183
2-[(2-chloro-5-piperazin-1-ylsulfonylphenyl)methoxy]-N-methoxy-N-methylacetamide (PubChem CID 86610183) has the molecular formula C15H22ClN3O5S and a molecular weight of 391.88 g/mol. Its IUPAC name is 2-[(2-chloro-5-piperazin-1-ylsulfonylphenyl)methoxy]-N-methoxy-N-methylacetamide.
| Compound Name | 2-[(2-chloro-5-piperazin-1-ylsulfonylphenyl)methoxy]-N-methoxy-N-methylacetamide |
|---|---|
| PubChem CID | 86610183 |
| Molecular Formula | C15H22ClN3O5S |
| Molecular Weight | 391.88 g/mol |
| Exact Mass | 391.10 |
| IUPAC Name | 2-[(2-chloro-5-piperazin-1-ylsulfonylphenyl)methoxy]-N-methoxy-N-methylacetamide |
| SMILES | CON(C)C(=O)COCc1cc(S(=O)(=O)N2CCNCC2)ccc1Cl |
| InChI | InChI=1S/C15H22ClN3O5S/c1-18(23-2)15(20)11-24-10-12-9-13(3-4-14(12)16)25(21,22)19-7-5-17-6-8-19/h3-4,9,17H,5-8,10-11H2,1-2H3 |
| InChIKey | HQBHZGGFNHECHP-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.88 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|