C17H15Cl2N5O2S2 — CID 86611701
N'-[(3,4-dichlorophenyl)methylamino]-4-(1,3-thiazol-2-ylsulfamoyl)benzenecarboximidamide (PubChem CID 86611701) has the molecular formula C17H15Cl2N5O2S2 and a molecular weight of 456.38 g/mol. Its IUPAC name is N'-[(3,4-dichlorophenyl)methylamino]-4-(1,3-thiazol-2-ylsulfamoyl)benzenecarboximidamide.
| Compound Name | N'-[(3,4-dichlorophenyl)methylamino]-4-(1,3-thiazol-2-ylsulfamoyl)benzenecarboximidamide |
|---|---|
| PubChem CID | 86611701 |
| Molecular Formula | C17H15Cl2N5O2S2 |
| Molecular Weight | 456.38 g/mol |
| Exact Mass | 455.00 |
| IUPAC Name | N'-[(3,4-dichlorophenyl)methylamino]-4-(1,3-thiazol-2-ylsulfamoyl)benzenecarboximidamide |
| SMILES | NC(=NNCc1ccc(Cl)c(Cl)c1)c1ccc(S(=O)(=O)Nc2nccs2)cc1 |
| InChI | InChI=1S/C17H15Cl2N5O2S2/c18-14-6-1-11(9-15(14)19)10-22-23-16(20)12-2-4-13(5-3-12)28(25,26)24-17-21-7-8-27-17/h1-9,22H,10H2,(H2,20,23)(H,21,24) |
| InChIKey | WGJDGAHVZGHBRP-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 109.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.38 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|