C21H34FNO4Si — CID 86614118
tert-butyl N-[(2S,3S)-3-[tert-butyl(dimethyl)silyl]oxy-1-(3-fluorophenyl)-4-oxobutan-2-yl]carbamate (PubChem CID 86614118) has the molecular formula C21H34FNO4Si and a molecular weight of 411.59 g/mol. Its IUPAC name is tert-butyl N-[(2S,3S)-3-[tert-butyl(dimethyl)silyl]oxy-1-(3-fluorophenyl)-4-oxobutan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S,3S)-3-[tert-butyl(dimethyl)silyl]oxy-1-(3-fluorophenyl)-4-oxobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 86614118 |
| Molecular Formula | C21H34FNO4Si |
| Molecular Weight | 411.59 g/mol |
| Exact Mass | 411.22 |
| IUPAC Name | tert-butyl N-[(2S,3S)-3-[tert-butyl(dimethyl)silyl]oxy-1-(3-fluorophenyl)-4-oxobutan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H](Cc1cccc(F)c1)[C@@H](C=O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C21H34FNO4Si/c1-20(2,3)26-19(25)23-17(13-15-10-9-11-16(22)12-15)18(14-24)27-28(7,8)21(4,5)6/h9-12,14,17-18H,13H2,1-8H3,(H,23,25)/t17-,18+/m0/s1 |
| InChIKey | GJQCIUCPNVIROB-ZWKOTPCHSA-N |
| XLogP | 4.85 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.59 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|