C13H15N3O — CID 86621434
(4S)-4-pyrimidin-5-yloxy-1-azatricyclo[3.3.1.13,7]dec-2-ene (PubChem CID 86621434) has the molecular formula C13H15N3O and a molecular weight of 229.28 g/mol. Its IUPAC name is (4S)-4-pyrimidin-5-yloxy-1-azatricyclo[3.3.1.13,7]dec-2-ene.
| Compound Name | (4S)-4-pyrimidin-5-yloxy-1-azatricyclo[3.3.1.13,7]dec-2-ene |
|---|---|
| PubChem CID | 86621434 |
| Molecular Formula | C13H15N3O |
| Molecular Weight | 229.28 g/mol |
| Exact Mass | 229.12 |
| IUPAC Name | (4S)-4-pyrimidin-5-yloxy-1-azatricyclo[3.3.1.13,7]dec-2-ene |
| SMILES | C1=C2CC3CC(CN1C3)[C@@H]2Oc1cncnc1 |
| InChI | InChI=1S/C13H15N3O/c1-9-2-11-7-16(5-9)6-10(1)13(11)17-12-3-14-8-15-4-12/h3-4,6,8-9,11,13H,1-2,5,7H2/t9?,11?,13-/m1/s1 |
| InChIKey | AQUSBESNZCGVNR-QEIKUCIBSA-N |
| XLogP | 1.46 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.28 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |