C11H10F2O — CID 86627697
1-(3,3-difluoropropoxy)-3-ethynylbenzene (PubChem CID 86627697) has the molecular formula C11H10F2O and a molecular weight of 196.20 g/mol. Its IUPAC name is 1-(3,3-difluoropropoxy)-3-ethynylbenzene.
| Compound Name | 1-(3,3-difluoropropoxy)-3-ethynylbenzene |
|---|---|
| PubChem CID | 86627697 |
| Molecular Formula | C11H10F2O |
| Molecular Weight | 196.20 g/mol |
| Exact Mass | 196.07 |
| IUPAC Name | 1-(3,3-difluoropropoxy)-3-ethynylbenzene |
| SMILES | C#Cc1cccc(OCCC(F)F)c1 |
| InChI | InChI=1S/C11H10F2O/c1-2-9-4-3-5-10(8-9)14-7-6-11(12)13/h1,3-5,8,11H,6-7H2 |
| InChIKey | CSEIWZRBXZWVGR-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.20 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|