C18H15N5O2 — CID 86658970
N-[4-[(6-amino-5-formylpyrimidin-4-yl)amino]phenyl]benzamide (PubChem CID 86658970) has the molecular formula C18H15N5O2 and a molecular weight of 333.35 g/mol. Its IUPAC name is N-[4-[(6-amino-5-formylpyrimidin-4-yl)amino]phenyl]benzamide.
| Compound Name | N-[4-[(6-amino-5-formylpyrimidin-4-yl)amino]phenyl]benzamide |
|---|---|
| PubChem CID | 86658970 |
| Molecular Formula | C18H15N5O2 |
| Molecular Weight | 333.35 g/mol |
| Exact Mass | 333.12 |
| IUPAC Name | N-[4-[(6-amino-5-formylpyrimidin-4-yl)amino]phenyl]benzamide |
| SMILES | Nc1ncnc(Nc2ccc(NC(=O)c3ccccc3)cc2)c1C=O |
| InChI | InChI=1S/C18H15N5O2/c19-16-15(10-24)17(21-11-20-16)22-13-6-8-14(9-7-13)23-18(25)12-4-2-1-3-5-12/h1-11H,(H,23,25)(H3,19,20,21,22) |
| InChIKey | ABXBRHQLGPRAOI-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 110.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.35 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|