C20H19N5O2 — CID 143505896
methyl 4-[4-[[6-amino-5-(methyliminomethyl)pyrimidin-4-yl]amino]phenyl]benzoate (PubChem CID 143505896) has the molecular formula C20H19N5O2 and a molecular weight of 361.41 g/mol. Its IUPAC name is methyl 4-[4-[[6-amino-5-(methyliminomethyl)pyrimidin-4-yl]amino]phenyl]benzoate.
| Compound Name | methyl 4-[4-[[6-amino-5-(methyliminomethyl)pyrimidin-4-yl]amino]phenyl]benzoate |
|---|---|
| PubChem CID | 143505896 |
| Molecular Formula | C20H19N5O2 |
| Molecular Weight | 361.41 g/mol |
| Exact Mass | 361.15 |
| IUPAC Name | methyl 4-[4-[[6-amino-5-(methyliminomethyl)pyrimidin-4-yl]amino]phenyl]benzoate |
| SMILES | C/N=C/c1c(N)ncnc1Nc1ccc(-c2ccc(C(=O)OC)cc2)cc1 |
| InChI | InChI=1S/C20H19N5O2/c1-22-11-17-18(21)23-12-24-19(17)25-16-9-7-14(8-10-16)13-3-5-15(6-4-13)20(26)27-2/h3-12H,1-2H3,(H3,21,23,24,25)/b22-11+ |
| InChIKey | ZKJLWNNAZVJKIU-SSDVNMTOSA-N |
| XLogP | 3.30 |
| TPSA | 102.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.41 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|